C14H23BrN2O2 — CID 104652116
N-[1-(5-bromofuran-2-yl)ethyl]-2-methyl-2-morpholin-4-ylpropan-1-amine (PubChem CID 104652116) has the molecular formula C14H23BrN2O2 and a molecular weight of 331.25 g/mol. Its IUPAC name is N-[1-(5-bromofuran-2-yl)ethyl]-2-methyl-2-morpholin-4-ylpropan-1-amine.
| Compound Name | N-[1-(5-bromofuran-2-yl)ethyl]-2-methyl-2-morpholin-4-ylpropan-1-amine |
|---|---|
| PubChem CID | 104652116 |
| Molecular Formula | C14H23BrN2O2 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | N-[1-(5-bromofuran-2-yl)ethyl]-2-methyl-2-morpholin-4-ylpropan-1-amine |
| SMILES | CC(NCC(C)(C)N1CCOCC1)c1ccc(Br)o1 |
| InChI | InChI=1S/C14H23BrN2O2/c1-11(12-4-5-13(15)19-12)16-10-14(2,3)17-6-8-18-9-7-17/h4-5,11,16H,6-10H2,1-3H3 |
| InChIKey | MSEWIKIMMNIZNP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |