C12H20O2 — CID 10465283
2-[(1R,2S,3R,4S)-3-(hydroxymethyl)-2-bicyclo[2.2.2]oct-5-enyl]propan-2-ol (PubChem CID 10465283) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-[(1R,2S,3R,4S)-3-(hydroxymethyl)-2-bicyclo[2.2.2]oct-5-enyl]propan-2-ol.
| Compound Name | 2-[(1R,2S,3R,4S)-3-(hydroxymethyl)-2-bicyclo[2.2.2]oct-5-enyl]propan-2-ol |
|---|---|
| PubChem CID | 10465283 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 2-[(1R,2S,3R,4S)-3-(hydroxymethyl)-2-bicyclo[2.2.2]oct-5-enyl]propan-2-ol |
| SMILES | CC(C)(O)[C@@H]1[C@H](CO)[C@@H]2C=C[C@H]1CC2 |
| InChI | InChI=1S/C12H20O2/c1-12(2,14)11-9-5-3-8(4-6-9)10(11)7-13/h3,5,8-11,13-14H,4,6-7H2,1-2H3/t8-,9+,10-,11+/m1/s1 |
| InChIKey | IRHIIUXFUBIBOU-YTWAJWBKSA-N |
| XLogP | 1.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|