C10H13BrF3NO2 — CID 104653014
1-(5-bromofuran-2-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine (PubChem CID 104653014) has the molecular formula C10H13BrF3NO2 and a molecular weight of 316.12 g/mol. Its IUPAC name is 1-(5-bromofuran-2-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine.
| Compound Name | 1-(5-bromofuran-2-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 104653014 |
| Molecular Formula | C10H13BrF3NO2 |
| Molecular Weight | 316.12 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 1-(5-bromofuran-2-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine |
| SMILES | CC(NCCOCC(F)(F)F)c1ccc(Br)o1 |
| InChI | InChI=1S/C10H13BrF3NO2/c1-7(8-2-3-9(11)17-8)15-4-5-16-6-10(12,13)14/h2-3,7,15H,4-6H2,1H3 |
| InChIKey | XPZNNIQOBFVUOY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.12 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|