C10H16O4 — CID 10465390
(2S,3R)-5-oxo-2-pentyloxolane-3-carboxylic acid (PubChem CID 10465390) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (2S,3R)-5-oxo-2-pentyloxolane-3-carboxylic acid.
| Compound Name | (2S,3R)-5-oxo-2-pentyloxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 10465390 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (2S,3R)-5-oxo-2-pentyloxolane-3-carboxylic acid |
| SMILES | CCCCC[C@@H]1OC(=O)C[C@H]1C(=O)O |
| InChI | InChI=1S/C10H16O4/c1-2-3-4-5-8-7(10(12)13)6-9(11)14-8/h7-8H,2-6H2,1H3,(H,12,13)/t7-,8+/m1/s1 |
| InChIKey | UEECRARBSXJSKY-SFYZADRCSA-N |
| XLogP | 1.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|