C11H18BrNO2 — CID 104653909
2-(5-bromofuran-2-yl)-2-(butan-2-ylamino)propan-1-ol (PubChem CID 104653909) has the molecular formula C11H18BrNO2 and a molecular weight of 276.17 g/mol. Its IUPAC name is 2-(5-bromofuran-2-yl)-2-(butan-2-ylamino)propan-1-ol.
| Compound Name | 2-(5-bromofuran-2-yl)-2-(butan-2-ylamino)propan-1-ol |
|---|---|
| PubChem CID | 104653909 |
| Molecular Formula | C11H18BrNO2 |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2-(5-bromofuran-2-yl)-2-(butan-2-ylamino)propan-1-ol |
| SMILES | CCC(C)NC(C)(CO)c1ccc(Br)o1 |
| InChI | InChI=1S/C11H18BrNO2/c1-4-8(2)13-11(3,7-14)9-5-6-10(12)15-9/h5-6,8,13-14H,4,7H2,1-3H3 |
| InChIKey | ZDGTYBNXYYWKFE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |