C12H13FN2O5S — CID 104654715
2-fluoro-5-[(1-methyl-2-oxopyrrolidin-3-yl)sulfamoyl]benzoic acid (PubChem CID 104654715) has the molecular formula C12H13FN2O5S and a molecular weight of 316.31 g/mol. Its IUPAC name is 2-fluoro-5-[(1-methyl-2-oxopyrrolidin-3-yl)sulfamoyl]benzoic acid.
| Compound Name | 2-fluoro-5-[(1-methyl-2-oxopyrrolidin-3-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 104654715 |
| Molecular Formula | C12H13FN2O5S |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-fluoro-5-[(1-methyl-2-oxopyrrolidin-3-yl)sulfamoyl]benzoic acid |
| SMILES | CN1CCC(NS(=O)(=O)c2ccc(F)c(C(=O)O)c2)C1=O |
| InChI | InChI=1S/C12H13FN2O5S/c1-15-5-4-10(11(15)16)14-21(19,20)7-2-3-9(13)8(6-7)12(17)18/h2-3,6,10,14H,4-5H2,1H3,(H,17,18) |
| InChIKey | JNSMJMGTPNOAKW-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |