About (6E)-8-hydroxy-4,8-dimethyl-6-prop-2-enylidenespiro[2.5]oct-4-en-7-one
(6E)-8-hydroxy-4,8-dimethyl-6-prop-2-enylidenespiro[2.5]oct-4-en-7-one (PubChem CID 10465516) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is (6E)-8-hydroxy-4,8-dimethyl-6-prop-2-enylidenespiro[2.5]oct-4-en-7-one.
Molecular Properties
| Compound Name | (6E)-8-hydroxy-4,8-dimethyl-6-prop-2-enylidenespiro[2.5]oct-4-en-7-one |
| PubChem CID | 10465516 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (6E)-8-hydroxy-4,8-dimethyl-6-prop-2-enylidenespiro[2.5]oct-4-en-7-one |
| SMILES | C=C/C=C1\C=C(C)C2(CC2)C(C)(O)C1=O |
| InChI | InChI=1S/C13H16O2/c1-4-5-10-8-9(2)13(6-7-13)12(3,15)11(10)14/h4-5,8,15H,1,6-7H2,2-3H3/b10-5+ |
| InChIKey | AVNTUXBWVZOFGI-BJMVGYQFSA-N |
| XLogP | 2.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (6E)-8-hydroxy-4,8-dimethyl-6-prop-2-enylidenespiro[2.5]oct-4-en-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-8-hydroxy-4,8-dimethyl-6-prop-2-enylidenespiro[2.5]oct-4-en-7-one?
The IUPAC name of (6E)-8-hydroxy-4,8-dimethyl-6-prop-2-enylidenespiro[2.5]oct-4-en-7-one (CID 10465516) is (6E)-8-hydroxy-4,8-dimethyl-6-prop-2-enylidenespiro[2.5]oct-4-en-7-one.
What is the SMILES notation for (6E)-8-hydroxy-4,8-dimethyl-6-prop-2-enylidenespiro[2.5]oct-4-en-7-one?
The canonical SMILES for (6E)-8-hydroxy-4,8-dimethyl-6-prop-2-enylidenespiro[2.5]oct-4-en-7-one is C=C/C=C1\C=C(C)C2(CC2)C(C)(O)C1=O.
What is the InChIKey of (6E)-8-hydroxy-4,8-dimethyl-6-prop-2-enylidenespiro[2.5]oct-4-en-7-one?
The InChIKey is AVNTUXBWVZOFGI-BJMVGYQFSA-N. The full InChI is InChI=1S/C13H16O2/c1-4-5-10-8-9(2)13(6-7-13)12(3,15)11(10)14/h4-5,8,15H,1,6-7H2,2-3H3/b10-5+.
What are the key properties of (6E)-8-hydroxy-4,8-dimethyl-6-prop-2-enylidenespiro[2.5]oct-4-en-7-one?
(6E)-8-hydroxy-4,8-dimethyl-6-prop-2-enylidenespiro[2.5]oct-4-en-7-one has a molecular weight of 204.27 g/mol, XLogP of 2.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-8-hydroxy-4,8-dimethyl-6-prop-2-enylidenespiro[2.5]oct-4-en-7-one is sourced from PubChem (CID 10465516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).