C14H20BrN — CID 104655434
N-[1-(2-bromophenyl)ethyl]hex-5-en-2-amine (PubChem CID 104655434) has the molecular formula C14H20BrN and a molecular weight of 282.23 g/mol. Its IUPAC name is N-[1-(2-bromophenyl)ethyl]hex-5-en-2-amine.
| Compound Name | N-[1-(2-bromophenyl)ethyl]hex-5-en-2-amine |
|---|---|
| PubChem CID | 104655434 |
| Molecular Formula | C14H20BrN |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-[1-(2-bromophenyl)ethyl]hex-5-en-2-amine |
| SMILES | C=CCCC(C)NC(C)c1ccccc1Br |
| InChI | InChI=1S/C14H20BrN/c1-4-5-8-11(2)16-12(3)13-9-6-7-10-14(13)15/h4,6-7,9-12,16H,1,5,8H2,2-3H3 |
| InChIKey | PRQLOZJHVRMCKZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|