C10H17N3 — CID 104655741
N-(1H-imidazol-5-ylmethyl)hex-5-en-2-amine (PubChem CID 104655741) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is N-(1H-imidazol-5-ylmethyl)hex-5-en-2-amine.
| Compound Name | N-(1H-imidazol-5-ylmethyl)hex-5-en-2-amine |
|---|---|
| PubChem CID | 104655741 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | N-(1H-imidazol-5-ylmethyl)hex-5-en-2-amine |
| SMILES | C=CCCC(C)NCc1cnc[nH]1 |
| InChI | InChI=1S/C10H17N3/c1-3-4-5-9(2)12-7-10-6-11-8-13-10/h3,6,8-9,12H,1,4-5,7H2,2H3,(H,11,13) |
| InChIKey | UMXXFFUISCGZLY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|