About O-[(2-methyl-2-phenyl-1,3-dioxolan-4-yl)methyl]hydroxylamine
O-[(2-methyl-2-phenyl-1,3-dioxolan-4-yl)methyl]hydroxylamine (PubChem CID 10465682) has the molecular formula C11H15NO3
and a molecular weight of 209.24 g/mol. Its IUPAC name is O-[(2-methyl-2-phenyl-1,3-dioxolan-4-yl)methyl]hydroxylamine.
Molecular Properties
| Compound Name | O-[(2-methyl-2-phenyl-1,3-dioxolan-4-yl)methyl]hydroxylamine |
| PubChem CID | 10465682 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | O-[(2-methyl-2-phenyl-1,3-dioxolan-4-yl)methyl]hydroxylamine |
| SMILES | CC1(c2ccccc2)OCC(CON)O1 |
| InChI | InChI=1S/C11H15NO3/c1-11(9-5-3-2-4-6-9)13-7-10(15-11)8-14-12/h2-6,10H,7-8,12H2,1H3 |
| InChIKey | XCWMKRVFLSBRPU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-[(2-methyl-2-phenyl-1,3-dioxolan-4-yl)methyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[(2-methyl-2-phenyl-1,3-dioxolan-4-yl)methyl]hydroxylamine?
The IUPAC name of O-[(2-methyl-2-phenyl-1,3-dioxolan-4-yl)methyl]hydroxylamine (CID 10465682) is O-[(2-methyl-2-phenyl-1,3-dioxolan-4-yl)methyl]hydroxylamine.
What is the SMILES notation for O-[(2-methyl-2-phenyl-1,3-dioxolan-4-yl)methyl]hydroxylamine?
The canonical SMILES for O-[(2-methyl-2-phenyl-1,3-dioxolan-4-yl)methyl]hydroxylamine is CC1(c2ccccc2)OCC(CON)O1.
What is the InChIKey of O-[(2-methyl-2-phenyl-1,3-dioxolan-4-yl)methyl]hydroxylamine?
The InChIKey is XCWMKRVFLSBRPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3/c1-11(9-5-3-2-4-6-9)13-7-10(15-11)8-14-12/h2-6,10H,7-8,12H2,1H3.
What are the key properties of O-[(2-methyl-2-phenyl-1,3-dioxolan-4-yl)methyl]hydroxylamine?
O-[(2-methyl-2-phenyl-1,3-dioxolan-4-yl)methyl]hydroxylamine has a molecular weight of 209.24 g/mol, XLogP of 1.16, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-[(2-methyl-2-phenyl-1,3-dioxolan-4-yl)methyl]hydroxylamine is sourced from PubChem (CID 10465682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).