About (5S,6S)-6-[(E)-hex-1-enyl]-4,5-dimethylmorpholin-2-one
(5S,6S)-6-[(E)-hex-1-enyl]-4,5-dimethylmorpholin-2-one (PubChem CID 10465755) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is (5S,6S)-6-[(E)-hex-1-enyl]-4,5-dimethylmorpholin-2-one.
Molecular Properties
| Compound Name | (5S,6S)-6-[(E)-hex-1-enyl]-4,5-dimethylmorpholin-2-one |
| PubChem CID | 10465755 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (5S,6S)-6-[(E)-hex-1-enyl]-4,5-dimethylmorpholin-2-one |
| SMILES | CCCC/C=C/[C@@H]1OC(=O)CN(C)[C@H]1C |
| InChI | InChI=1S/C12H21NO2/c1-4-5-6-7-8-11-10(2)13(3)9-12(14)15-11/h7-8,10-11H,4-6,9H2,1-3H3/b8-7+/t10-,11-/m0/s1 |
| InChIKey | RLKPJWFHMZVVKF-IJUHFESZSA-N |
| XLogP | 1.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5S,6S)-6-[(E)-hex-1-enyl]-4,5-dimethylmorpholin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S,6S)-6-[(E)-hex-1-enyl]-4,5-dimethylmorpholin-2-one?
The IUPAC name of (5S,6S)-6-[(E)-hex-1-enyl]-4,5-dimethylmorpholin-2-one (CID 10465755) is (5S,6S)-6-[(E)-hex-1-enyl]-4,5-dimethylmorpholin-2-one.
What is the SMILES notation for (5S,6S)-6-[(E)-hex-1-enyl]-4,5-dimethylmorpholin-2-one?
The canonical SMILES for (5S,6S)-6-[(E)-hex-1-enyl]-4,5-dimethylmorpholin-2-one is CCCC/C=C/[C@@H]1OC(=O)CN(C)[C@H]1C.
What is the InChIKey of (5S,6S)-6-[(E)-hex-1-enyl]-4,5-dimethylmorpholin-2-one?
The InChIKey is RLKPJWFHMZVVKF-IJUHFESZSA-N. The full InChI is InChI=1S/C12H21NO2/c1-4-5-6-7-8-11-10(2)13(3)9-12(14)15-11/h7-8,10-11H,4-6,9H2,1-3H3/b8-7+/t10-,11-/m0/s1.
What are the key properties of (5S,6S)-6-[(E)-hex-1-enyl]-4,5-dimethylmorpholin-2-one?
(5S,6S)-6-[(E)-hex-1-enyl]-4,5-dimethylmorpholin-2-one has a molecular weight of 211.30 g/mol, XLogP of 1.98, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S,6S)-6-[(E)-hex-1-enyl]-4,5-dimethylmorpholin-2-one is sourced from PubChem (CID 10465755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).