C13H13BrN2OS — CID 104658435
4-[(E)-2-(3-bromo-4-ethoxyphenyl)ethenyl]-1,3-thiazol-2-amine (PubChem CID 104658435) has the molecular formula C13H13BrN2OS and a molecular weight of 325.23 g/mol. Its IUPAC name is 4-[(E)-2-(3-bromo-4-ethoxyphenyl)ethenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[(E)-2-(3-bromo-4-ethoxyphenyl)ethenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 104658435 |
| Molecular Formula | C13H13BrN2OS |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 4-[(E)-2-(3-bromo-4-ethoxyphenyl)ethenyl]-1,3-thiazol-2-amine |
| SMILES | CCOc1ccc(/C=C/c2csc(N)n2)cc1Br |
| InChI | InChI=1S/C13H13BrN2OS/c1-2-17-12-6-4-9(7-11(12)14)3-5-10-8-18-13(15)16-10/h3-8H,2H2,1H3,(H2,15,16)/b5-3+ |
| InChIKey | USUZADATVUQNQC-HWKANZROSA-N |
| XLogP | 4.06 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |