C14H14Br2O3 — CID 104658570
(4,5-dibromofuran-2-yl)-(2-propoxyphenyl)methanol (PubChem CID 104658570) has the molecular formula C14H14Br2O3 and a molecular weight of 390.07 g/mol. Its IUPAC name is (4,5-dibromofuran-2-yl)-(2-propoxyphenyl)methanol.
| Compound Name | (4,5-dibromofuran-2-yl)-(2-propoxyphenyl)methanol |
|---|---|
| PubChem CID | 104658570 |
| Molecular Formula | C14H14Br2O3 |
| Molecular Weight | 390.07 g/mol |
| Exact Mass | 387.93 |
| IUPAC Name | (4,5-dibromofuran-2-yl)-(2-propoxyphenyl)methanol |
| SMILES | CCCOc1ccccc1C(O)c1cc(Br)c(Br)o1 |
| InChI | InChI=1S/C14H14Br2O3/c1-2-7-18-11-6-4-3-5-9(11)13(17)12-8-10(15)14(16)19-12/h3-6,8,13,17H,2,7H2,1H3 |
| InChIKey | SUGRECXMQZUHJH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.07 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |