C13H20O5 — CID 104658798
2,2-dimethoxy-1-[2-(2-methoxyethoxy)phenyl]ethanol (PubChem CID 104658798) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2,2-dimethoxy-1-[2-(2-methoxyethoxy)phenyl]ethanol.
| Compound Name | 2,2-dimethoxy-1-[2-(2-methoxyethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 104658798 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2,2-dimethoxy-1-[2-(2-methoxyethoxy)phenyl]ethanol |
| SMILES | COCCOc1ccccc1C(O)C(OC)OC |
| InChI | InChI=1S/C13H20O5/c1-15-8-9-18-11-7-5-4-6-10(11)12(14)13(16-2)17-3/h4-7,12-14H,8-9H2,1-3H3 |
| InChIKey | ZJDBGBWWTMSMOX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|