C10H16O5 — CID 10465888
methyl 2-[(2R,3S,6S)-6-ethoxy-3-hydroxy-3,6-dihydro-2H-pyran-2-yl]acetate (PubChem CID 10465888) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is methyl 2-[(2R,3S,6S)-6-ethoxy-3-hydroxy-3,6-dihydro-2H-pyran-2-yl]acetate.
| Compound Name | methyl 2-[(2R,3S,6S)-6-ethoxy-3-hydroxy-3,6-dihydro-2H-pyran-2-yl]acetate |
|---|---|
| PubChem CID | 10465888 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | methyl 2-[(2R,3S,6S)-6-ethoxy-3-hydroxy-3,6-dihydro-2H-pyran-2-yl]acetate |
| SMILES | CCO[C@@H]1C=C[C@H](O)[C@@H](CC(=O)OC)O1 |
| InChI | InChI=1S/C10H16O5/c1-3-14-10-5-4-7(11)8(15-10)6-9(12)13-2/h4-5,7-8,10-11H,3,6H2,1-2H3/t7-,8+,10-/m0/s1 |
| InChIKey | QPSQRKQYPQQTEL-XKSSXDPKSA-N |
| XLogP | 0.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|