C15H25NOS — CID 104660213
N-methyl-2-propan-2-ylsulfanyl-1-(2-propoxyphenyl)ethanamine (PubChem CID 104660213) has the molecular formula C15H25NOS and a molecular weight of 267.44 g/mol. Its IUPAC name is N-methyl-2-propan-2-ylsulfanyl-1-(2-propoxyphenyl)ethanamine.
| Compound Name | N-methyl-2-propan-2-ylsulfanyl-1-(2-propoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 104660213 |
| Molecular Formula | C15H25NOS |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | N-methyl-2-propan-2-ylsulfanyl-1-(2-propoxyphenyl)ethanamine |
| SMILES | CCCOc1ccccc1C(CSC(C)C)NC |
| InChI | InChI=1S/C15H25NOS/c1-5-10-17-15-9-7-6-8-13(15)14(16-4)11-18-12(2)3/h6-9,12,14,16H,5,10-11H2,1-4H3 |
| InChIKey | ZKLHFYQDFWNAQO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |