C17H29N3O — CID 104660642
(1,4-dimethyl-1,4-diazepan-2-yl)-(2-propoxyphenyl)methanamine (PubChem CID 104660642) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is (1,4-dimethyl-1,4-diazepan-2-yl)-(2-propoxyphenyl)methanamine.
| Compound Name | (1,4-dimethyl-1,4-diazepan-2-yl)-(2-propoxyphenyl)methanamine |
|---|---|
| PubChem CID | 104660642 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | (1,4-dimethyl-1,4-diazepan-2-yl)-(2-propoxyphenyl)methanamine |
| SMILES | CCCOc1ccccc1C(N)C1CN(C)CCCN1C |
| InChI | InChI=1S/C17H29N3O/c1-4-12-21-16-9-6-5-8-14(16)17(18)15-13-19(2)10-7-11-20(15)3/h5-6,8-9,15,17H,4,7,10-13,18H2,1-3H3 |
| InChIKey | PRQCQQVQPJTRAW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |