C14H14ClNO3S — CID 104663044
methyl 4-chloro-2-(2-propoxyphenyl)-1,3-thiazole-5-carboxylate (PubChem CID 104663044) has the molecular formula C14H14ClNO3S and a molecular weight of 311.79 g/mol. Its IUPAC name is methyl 4-chloro-2-(2-propoxyphenyl)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 4-chloro-2-(2-propoxyphenyl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 104663044 |
| Molecular Formula | C14H14ClNO3S |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | methyl 4-chloro-2-(2-propoxyphenyl)-1,3-thiazole-5-carboxylate |
| SMILES | CCCOc1ccccc1-c1nc(Cl)c(C(=O)OC)s1 |
| InChI | InChI=1S/C14H14ClNO3S/c1-3-8-19-10-7-5-4-6-9(10)13-16-12(15)11(20-13)14(17)18-2/h4-7H,3,8H2,1-2H3 |
| InChIKey | ZBCNSZIKNGKYAU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |