C15H19NO — CID 10466367
[(1S,2R)-1-(benzyliminomethyl)-2-[(E)-prop-1-enyl]cyclopropyl]methanol (PubChem CID 10466367) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is [(1S,2R)-1-(benzyliminomethyl)-2-[(E)-prop-1-enyl]cyclopropyl]methanol.
| Compound Name | [(1S,2R)-1-(benzyliminomethyl)-2-[(E)-prop-1-enyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 10466367 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | [(1S,2R)-1-(benzyliminomethyl)-2-[(E)-prop-1-enyl]cyclopropyl]methanol |
| SMILES | C/C=C/[C@H]1C[C@]1(/C=N/Cc1ccccc1)CO |
| InChI | InChI=1S/C15H19NO/c1-2-6-14-9-15(14,12-17)11-16-10-13-7-4-3-5-8-13/h2-8,11,14,17H,9-10,12H2,1H3/b6-2+,16-11+/t14-,15-/m0/s1 |
| InChIKey | CYFWFESSAZZKFE-WLEHEBMASA-N |
| XLogP | 2.83 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|