C16H26ClNO — CID 104663679
3-[1-(3-chlorophenyl)propylamino]-4,4-dimethylpentan-1-ol (PubChem CID 104663679) has the molecular formula C16H26ClNO and a molecular weight of 283.84 g/mol. Its IUPAC name is 3-[1-(3-chlorophenyl)propylamino]-4,4-dimethylpentan-1-ol.
| Compound Name | 3-[1-(3-chlorophenyl)propylamino]-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 104663679 |
| Molecular Formula | C16H26ClNO |
| Molecular Weight | 283.84 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 3-[1-(3-chlorophenyl)propylamino]-4,4-dimethylpentan-1-ol |
| SMILES | CCC(NC(CCO)C(C)(C)C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H26ClNO/c1-5-14(12-7-6-8-13(17)11-12)18-15(9-10-19)16(2,3)4/h6-8,11,14-15,18-19H,5,9-10H2,1-4H3 |
| InChIKey | HVYYNHDLEWHRNR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.84 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |