C16H24ClNO2 — CID 104663878
4-chloro-2-[[(2,4-dimethylcyclohexyl)amino]methyl]-6-methoxyphenol (PubChem CID 104663878) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is 4-chloro-2-[[(2,4-dimethylcyclohexyl)amino]methyl]-6-methoxyphenol.
| Compound Name | 4-chloro-2-[[(2,4-dimethylcyclohexyl)amino]methyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 104663878 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-chloro-2-[[(2,4-dimethylcyclohexyl)amino]methyl]-6-methoxyphenol |
| SMILES | COc1cc(Cl)cc(CNC2CCC(C)CC2C)c1O |
| InChI | InChI=1S/C16H24ClNO2/c1-10-4-5-14(11(2)6-10)18-9-12-7-13(17)8-15(20-3)16(12)19/h7-8,10-11,14,18-19H,4-6,9H2,1-3H3 |
| InChIKey | QKRSPZCNGBGPLG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|