C15H24O2 — CID 10466652
(1S,3S,4aR,7S,8S,8aS)-8-(hydroxymethyl)-7-methyl-3-[(E)-prop-1-enyl]-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-ol (PubChem CID 10466652) has the molecular formula C15H24O2 and a molecular weight of 236.36 g/mol. Its IUPAC name is (1S,3S,4aR,7S,8S,8aS)-8-(hydroxymethyl)-7-methyl-3-[(E)-prop-1-enyl]-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-ol.
| Compound Name | (1S,3S,4aR,7S,8S,8aS)-8-(hydroxymethyl)-7-methyl-3-[(E)-prop-1-enyl]-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 10466652 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (1S,3S,4aR,7S,8S,8aS)-8-(hydroxymethyl)-7-methyl-3-[(E)-prop-1-enyl]-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-ol |
| SMILES | C/C=C/[C@@H]1C[C@H](O)[C@@H]2[C@@H](CO)[C@@H](C)C=C[C@H]2C1 |
| InChI | InChI=1S/C15H24O2/c1-3-4-11-7-12-6-5-10(2)13(9-16)15(12)14(17)8-11/h3-6,10-17H,7-9H2,1-2H3/b4-3+/t10-,11-,12-,13-,14-,15-/m0/s1 |
| InChIKey | XOEICZWQBQNFPS-MROCWANLSA-N |
| XLogP | 2.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|