C14H23NO2 — CID 10466690
3-[(E)-dec-2-enyl]pyrrolidine-2,5-dione (PubChem CID 10466690) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 3-[(E)-dec-2-enyl]pyrrolidine-2,5-dione.
| Compound Name | 3-[(E)-dec-2-enyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 10466690 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 3-[(E)-dec-2-enyl]pyrrolidine-2,5-dione |
| SMILES | CCCCCCC/C=C/CC1CC(=O)NC1=O |
| InChI | InChI=1S/C14H23NO2/c1-2-3-4-5-6-7-8-9-10-12-11-13(16)15-14(12)17/h8-9,12H,2-7,10-11H2,1H3,(H,15,16,17)/b9-8+ |
| InChIKey | JNEMIKDTGXTWPK-CMDGGOBGSA-N |
| XLogP | 2.96 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|