C15H15NO2 — CID 10466871
1,4,6,8-tetramethylfuro[2,3-h]quinolin-2-one (PubChem CID 10466871) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 1,4,6,8-tetramethylfuro[2,3-h]quinolin-2-one.
| Compound Name | 1,4,6,8-tetramethylfuro[2,3-h]quinolin-2-one |
|---|---|
| PubChem CID | 10466871 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 1,4,6,8-tetramethylfuro[2,3-h]quinolin-2-one |
| SMILES | Cc1cc2c(o1)c(C)cc1c(C)cc(=O)n(C)c12 |
| InChI | InChI=1S/C15H15NO2/c1-8-6-13(17)16(4)14-11(8)5-9(2)15-12(14)7-10(3)18-15/h5-7H,1-4H3 |
| InChIKey | BNKSKQXNUGCBBE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |