C13H19FN2O — CID 104668781
6-fluoro-N-(2,2,5,5-tetramethyloxolan-3-yl)pyridin-3-amine (PubChem CID 104668781) has the molecular formula C13H19FN2O and a molecular weight of 238.31 g/mol. Its IUPAC name is 6-fluoro-N-(2,2,5,5-tetramethyloxolan-3-yl)pyridin-3-amine.
| Compound Name | 6-fluoro-N-(2,2,5,5-tetramethyloxolan-3-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 104668781 |
| Molecular Formula | C13H19FN2O |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 6-fluoro-N-(2,2,5,5-tetramethyloxolan-3-yl)pyridin-3-amine |
| SMILES | CC1(C)CC(Nc2ccc(F)nc2)C(C)(C)O1 |
| InChI | InChI=1S/C13H19FN2O/c1-12(2)7-10(13(3,4)17-12)16-9-5-6-11(14)15-8-9/h5-6,8,10,16H,7H2,1-4H3 |
| InChIKey | HIQDLBWGZVZOPL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|