C13H14N4O — CID 104669075
N-(3-amino-2,6-dimethylphenyl)pyridazine-4-carboxamide (PubChem CID 104669075) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is N-(3-amino-2,6-dimethylphenyl)pyridazine-4-carboxamide.
| Compound Name | N-(3-amino-2,6-dimethylphenyl)pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 104669075 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N-(3-amino-2,6-dimethylphenyl)pyridazine-4-carboxamide |
| SMILES | Cc1ccc(N)c(C)c1NC(=O)c1ccnnc1 |
| InChI | InChI=1S/C13H14N4O/c1-8-3-4-11(14)9(2)12(8)17-13(18)10-5-6-15-16-7-10/h3-7H,14H2,1-2H3,(H,17,18) |
| InChIKey | KLVNYMIGXXBZIJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|