C16H21NO — CID 10466960
(7R,8S)-8-prop-2-enyl-7-(prop-2-enylamino)-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 10466960) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is (7R,8S)-8-prop-2-enyl-7-(prop-2-enylamino)-5,6,7,8-tetrahydronaphthalen-1-ol.
| Compound Name | (7R,8S)-8-prop-2-enyl-7-(prop-2-enylamino)-5,6,7,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 10466960 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (7R,8S)-8-prop-2-enyl-7-(prop-2-enylamino)-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | C=CCN[C@@H]1CCc2cccc(O)c2[C@@H]1CC=C |
| InChI | InChI=1S/C16H21NO/c1-3-6-13-14(17-11-4-2)10-9-12-7-5-8-15(18)16(12)13/h3-5,7-8,13-14,17-18H,1-2,6,9-11H2/t13-,14-/m1/s1 |
| InChIKey | AJDDPGPDUSAKBQ-ZIAGYGMSSA-N |
| XLogP | 3.14 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|