C9H9ClN4O — CID 104669982
2-(chloromethyl)-5-(3,6-dimethylpyridazin-4-yl)-1,3,4-oxadiazole (PubChem CID 104669982) has the molecular formula C9H9ClN4O and a molecular weight of 224.65 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(3,6-dimethylpyridazin-4-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(chloromethyl)-5-(3,6-dimethylpyridazin-4-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 104669982 |
| Molecular Formula | C9H9ClN4O |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 2-(chloromethyl)-5-(3,6-dimethylpyridazin-4-yl)-1,3,4-oxadiazole |
| SMILES | Cc1cc(-c2nnc(CCl)o2)c(C)nn1 |
| InChI | InChI=1S/C9H9ClN4O/c1-5-3-7(6(2)12-11-5)9-14-13-8(4-10)15-9/h3H,4H2,1-2H3 |
| InChIKey | CQFDEIIJQGZXQU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|