C13H21N3O3 — CID 104670530
N-(1,1-dimethoxypropan-2-yl)-3-ethyl-6-methylpyridazine-4-carboxamide (PubChem CID 104670530) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is N-(1,1-dimethoxypropan-2-yl)-3-ethyl-6-methylpyridazine-4-carboxamide.
| Compound Name | N-(1,1-dimethoxypropan-2-yl)-3-ethyl-6-methylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 104670530 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N-(1,1-dimethoxypropan-2-yl)-3-ethyl-6-methylpyridazine-4-carboxamide |
| SMILES | CCc1nnc(C)cc1C(=O)NC(C)C(OC)OC |
| InChI | InChI=1S/C13H21N3O3/c1-6-11-10(7-8(2)15-16-11)12(17)14-9(3)13(18-4)19-5/h7,9,13H,6H2,1-5H3,(H,14,17) |
| InChIKey | OZFHQLWZOBGWCQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|