C16H15N3O2 — CID 104671804
N-[4-(4-hydroxybut-1-ynyl)-2-methylphenyl]pyridazine-4-carboxamide (PubChem CID 104671804) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is N-[4-(4-hydroxybut-1-ynyl)-2-methylphenyl]pyridazine-4-carboxamide.
| Compound Name | N-[4-(4-hydroxybut-1-ynyl)-2-methylphenyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 104671804 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-[4-(4-hydroxybut-1-ynyl)-2-methylphenyl]pyridazine-4-carboxamide |
| SMILES | Cc1cc(C#CCCO)ccc1NC(=O)c1ccnnc1 |
| InChI | InChI=1S/C16H15N3O2/c1-12-10-13(4-2-3-9-20)5-6-15(12)19-16(21)14-7-8-17-18-11-14/h5-8,10-11,20H,3,9H2,1H3,(H,19,21) |
| InChIKey | CMCFLOOOLSZCFK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|