About N-[1-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]pyridazine-4-carboxamide
N-[1-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]pyridazine-4-carboxamide (PubChem CID 104671949) has the molecular formula C12H17N5O2
and a molecular weight of 263.30 g/mol. Its IUPAC name is N-[1-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]pyridazine-4-carboxamide.
Molecular Properties
| Compound Name | N-[1-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]pyridazine-4-carboxamide |
| PubChem CID | 104671949 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | N-[1-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]pyridazine-4-carboxamide |
| SMILES | N/C(=N/O)C1(NC(=O)c2ccnnc2)CCCCC1 |
| InChI | InChI=1S/C12H17N5O2/c13-11(17-19)12(5-2-1-3-6-12)16-10(18)9-4-7-14-15-8-9/h4,7-8,19H,1-3,5-6H2,(H2,13,17)(H,16,18) |
| InChIKey | RFAKRIBOFHHFDI-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 113.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[1-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]pyridazine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]pyridazine-4-carboxamide?
The IUPAC name of N-[1-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]pyridazine-4-carboxamide (CID 104671949) is N-[1-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]pyridazine-4-carboxamide.
What is the SMILES notation for N-[1-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]pyridazine-4-carboxamide?
The canonical SMILES for N-[1-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]pyridazine-4-carboxamide is N/C(=N/O)C1(NC(=O)c2ccnnc2)CCCCC1.
What is the InChIKey of N-[1-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]pyridazine-4-carboxamide?
The InChIKey is RFAKRIBOFHHFDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N5O2/c13-11(17-19)12(5-2-1-3-6-12)16-10(18)9-4-7-14-15-8-9/h4,7-8,19H,1-3,5-6H2,(H2,13,17)(H,16,18).
What are the key properties of N-[1-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]pyridazine-4-carboxamide?
N-[1-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]pyridazine-4-carboxamide has a molecular weight of 263.30 g/mol, XLogP of 0.66, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(E)-N'-hydroxycarbamimidoyl]cyclohexyl]pyridazine-4-carboxamide is sourced from PubChem (CID 104671949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).