C13H21N5O2 — CID 104671954
N-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-3-ethyl-6-methylpyridazine-4-carboxamide (PubChem CID 104671954) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-3-ethyl-6-methylpyridazine-4-carboxamide.
| Compound Name | N-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-3-ethyl-6-methylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 104671954 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N-(1-amino-1-hydroxyimino-2-methylbutan-2-yl)-3-ethyl-6-methylpyridazine-4-carboxamide |
| SMILES | CCc1nnc(C)cc1C(=O)NC(C)(CC)C(N)=NO |
| InChI | InChI=1S/C13H21N5O2/c1-5-10-9(7-8(3)16-17-10)11(19)15-13(4,6-2)12(14)18-20/h7,20H,5-6H2,1-4H3,(H2,14,18)(H,15,19) |
| InChIKey | UCSBOCYPVDQQRN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 113.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|