C13H18N6 — CID 104672382
3-(3-ethyl-6-methylpyridazin-4-yl)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 104672382) has the molecular formula C13H18N6 and a molecular weight of 258.33 g/mol. Its IUPAC name is 3-(3-ethyl-6-methylpyridazin-4-yl)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-(3-ethyl-6-methylpyridazin-4-yl)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 104672382 |
| Molecular Formula | C13H18N6 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 3-(3-ethyl-6-methylpyridazin-4-yl)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | CCc1nnc(C)cc1-c1nnc2n1CCNC2C |
| InChI | InChI=1S/C13H18N6/c1-4-11-10(7-8(2)15-16-11)13-18-17-12-9(3)14-5-6-19(12)13/h7,9,14H,4-6H2,1-3H3 |
| InChIKey | FHKQPVIZXTYZGJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |