C14H14ClN3O2 — CID 104672631
N-[3-(chloromethyl)-4-ethoxyphenyl]pyridazine-4-carboxamide (PubChem CID 104672631) has the molecular formula C14H14ClN3O2 and a molecular weight of 291.74 g/mol. Its IUPAC name is N-[3-(chloromethyl)-4-ethoxyphenyl]pyridazine-4-carboxamide.
| Compound Name | N-[3-(chloromethyl)-4-ethoxyphenyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 104672631 |
| Molecular Formula | C14H14ClN3O2 |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | N-[3-(chloromethyl)-4-ethoxyphenyl]pyridazine-4-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2ccnnc2)cc1CCl |
| InChI | InChI=1S/C14H14ClN3O2/c1-2-20-13-4-3-12(7-11(13)8-15)18-14(19)10-5-6-16-17-9-10/h3-7,9H,2,8H2,1H3,(H,18,19) |
| InChIKey | FWDJHVKVDYUKNG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|