About 4-(4-chlorophenyl)-5-(3,6-dimethylpyridazin-4-yl)-1,2-oxazol-3-amine
4-(4-chlorophenyl)-5-(3,6-dimethylpyridazin-4-yl)-1,2-oxazol-3-amine (PubChem CID 104673131) has the molecular formula C15H13ClN4O
and a molecular weight of 300.75 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5-(3,6-dimethylpyridazin-4-yl)-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-5-(3,6-dimethylpyridazin-4-yl)-1,2-oxazol-3-amine |
| PubChem CID | 104673131 |
| Molecular Formula | C15H13ClN4O |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 4-(4-chlorophenyl)-5-(3,6-dimethylpyridazin-4-yl)-1,2-oxazol-3-amine |
| SMILES | Cc1cc(-c2onc(N)c2-c2ccc(Cl)cc2)c(C)nn1 |
| InChI | InChI=1S/C15H13ClN4O/c1-8-7-12(9(2)19-18-8)14-13(15(17)20-21-14)10-3-5-11(16)6-4-10/h3-7H,1-2H3,(H2,17,20) |
| InChIKey | GBRPZSFETOYLOY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-chlorophenyl)-5-(3,6-dimethylpyridazin-4-yl)-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-5-(3,6-dimethylpyridazin-4-yl)-1,2-oxazol-3-amine?
The IUPAC name of 4-(4-chlorophenyl)-5-(3,6-dimethylpyridazin-4-yl)-1,2-oxazol-3-amine (CID 104673131) is 4-(4-chlorophenyl)-5-(3,6-dimethylpyridazin-4-yl)-1,2-oxazol-3-amine.
What is the SMILES notation for 4-(4-chlorophenyl)-5-(3,6-dimethylpyridazin-4-yl)-1,2-oxazol-3-amine?
The canonical SMILES for 4-(4-chlorophenyl)-5-(3,6-dimethylpyridazin-4-yl)-1,2-oxazol-3-amine is Cc1cc(-c2onc(N)c2-c2ccc(Cl)cc2)c(C)nn1.
What is the InChIKey of 4-(4-chlorophenyl)-5-(3,6-dimethylpyridazin-4-yl)-1,2-oxazol-3-amine?
The InChIKey is GBRPZSFETOYLOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClN4O/c1-8-7-12(9(2)19-18-8)14-13(15(17)20-21-14)10-3-5-11(16)6-4-10/h3-7H,1-2H3,(H2,17,20).
What are the key properties of 4-(4-chlorophenyl)-5-(3,6-dimethylpyridazin-4-yl)-1,2-oxazol-3-amine?
4-(4-chlorophenyl)-5-(3,6-dimethylpyridazin-4-yl)-1,2-oxazol-3-amine has a molecular weight of 300.75 g/mol, XLogP of 3.65, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-5-(3,6-dimethylpyridazin-4-yl)-1,2-oxazol-3-amine is sourced from PubChem (CID 104673131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).