C14H19ClN2 — CID 10467315
(11R,11aR)-7-chloro-N-methyl-2,3,4,6,11,11a-hexahydro-1H-benzo[b]quinolizin-11-amine (PubChem CID 10467315) has the molecular formula C14H19ClN2 and a molecular weight of 250.77 g/mol. Its IUPAC name is (11R,11aR)-7-chloro-N-methyl-2,3,4,6,11,11a-hexahydro-1H-benzo[b]quinolizin-11-amine.
| Compound Name | (11R,11aR)-7-chloro-N-methyl-2,3,4,6,11,11a-hexahydro-1H-benzo[b]quinolizin-11-amine |
|---|---|
| PubChem CID | 10467315 |
| Molecular Formula | C14H19ClN2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (11R,11aR)-7-chloro-N-methyl-2,3,4,6,11,11a-hexahydro-1H-benzo[b]quinolizin-11-amine |
| SMILES | CN[C@@H]1c2cccc(Cl)c2CN2CCCC[C@H]12 |
| InChI | InChI=1S/C14H19ClN2/c1-16-14-10-5-4-6-12(15)11(10)9-17-8-3-2-7-13(14)17/h4-6,13-14,16H,2-3,7-9H2,1H3/t13-,14-/m1/s1 |
| InChIKey | OVTSZDYNNHWANJ-ZIAGYGMSSA-N |
| XLogP | 2.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |