C18H16F6N4O2S — CID 1046735
N-[2-[(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]pyridine-4-carboxamide (PubChem CID 1046735) has the molecular formula C18H16F6N4O2S and a molecular weight of 466.41 g/mol. Its IUPAC name is N-[2-[(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]pyridine-4-carboxamide.
| Compound Name | N-[2-[(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 1046735 |
| Molecular Formula | C18H16F6N4O2S |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | N-[2-[(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]pyridine-4-carboxamide |
| SMILES | NC(=O)c1c(NC(NC(=O)c2ccncc2)(C(F)(F)F)C(F)(F)F)sc2c1CCCC2 |
| InChI | InChI=1S/C18H16F6N4O2S/c19-17(20,21)16(18(22,23)24,27-14(30)9-5-7-26-8-6-9)28-15-12(13(25)29)10-3-1-2-4-11(10)31-15/h5-8,28H,1-4H2,(H2,25,29)(H,27,30) |
| InChIKey | UVANQPFSQRYIJV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|