About 2-(3-bromo-2-methoxycyclobutyl)oxy-1,3-difluorobenzene
2-(3-bromo-2-methoxycyclobutyl)oxy-1,3-difluorobenzene (PubChem CID 104674156) has the molecular formula C11H11BrF2O2
and a molecular weight of 293.11 g/mol. Its IUPAC name is 2-(3-bromo-2-methoxycyclobutyl)oxy-1,3-difluorobenzene.
Molecular Properties
| Compound Name | 2-(3-bromo-2-methoxycyclobutyl)oxy-1,3-difluorobenzene |
| PubChem CID | 104674156 |
| Molecular Formula | C11H11BrF2O2 |
| Molecular Weight | 293.11 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | 2-(3-bromo-2-methoxycyclobutyl)oxy-1,3-difluorobenzene |
| SMILES | COC1C(Br)CC1Oc1c(F)cccc1F |
| InChI | InChI=1S/C11H11BrF2O2/c1-15-10-6(12)5-9(10)16-11-7(13)3-2-4-8(11)14/h2-4,6,9-10H,5H2,1H3 |
| InChIKey | DIGZKXYUURBFKI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.11 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-bromo-2-methoxycyclobutyl)oxy-1,3-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromo-2-methoxycyclobutyl)oxy-1,3-difluorobenzene?
The IUPAC name of 2-(3-bromo-2-methoxycyclobutyl)oxy-1,3-difluorobenzene (CID 104674156) is 2-(3-bromo-2-methoxycyclobutyl)oxy-1,3-difluorobenzene.
What is the SMILES notation for 2-(3-bromo-2-methoxycyclobutyl)oxy-1,3-difluorobenzene?
The canonical SMILES for 2-(3-bromo-2-methoxycyclobutyl)oxy-1,3-difluorobenzene is COC1C(Br)CC1Oc1c(F)cccc1F.
What is the InChIKey of 2-(3-bromo-2-methoxycyclobutyl)oxy-1,3-difluorobenzene?
The InChIKey is DIGZKXYUURBFKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrF2O2/c1-15-10-6(12)5-9(10)16-11-7(13)3-2-4-8(11)14/h2-4,6,9-10H,5H2,1H3.
What are the key properties of 2-(3-bromo-2-methoxycyclobutyl)oxy-1,3-difluorobenzene?
2-(3-bromo-2-methoxycyclobutyl)oxy-1,3-difluorobenzene has a molecular weight of 293.11 g/mol, XLogP of 2.89, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromo-2-methoxycyclobutyl)oxy-1,3-difluorobenzene is sourced from PubChem (CID 104674156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).