C10H19ClO4 — CID 104674207
1-chloro-2-methoxy-3-[2-(2-methoxyethoxy)ethoxy]cyclobutane (PubChem CID 104674207) has the molecular formula C10H19ClO4 and a molecular weight of 238.71 g/mol. Its IUPAC name is 1-chloro-2-methoxy-3-[2-(2-methoxyethoxy)ethoxy]cyclobutane.
| Compound Name | 1-chloro-2-methoxy-3-[2-(2-methoxyethoxy)ethoxy]cyclobutane |
|---|---|
| PubChem CID | 104674207 |
| Molecular Formula | C10H19ClO4 |
| Molecular Weight | 238.71 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 1-chloro-2-methoxy-3-[2-(2-methoxyethoxy)ethoxy]cyclobutane |
| SMILES | COCCOCCOC1CC(Cl)C1OC |
| InChI | InChI=1S/C10H19ClO4/c1-12-3-4-14-5-6-15-9-7-8(11)10(9)13-2/h8-10H,3-7H2,1-2H3 |
| InChIKey | KLKZIMIZVUKSDA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.71 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|