C13H19NO2 — CID 104674259
3-(2,3-dimethylphenoxy)-2-methoxycyclobutan-1-amine (PubChem CID 104674259) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-(2,3-dimethylphenoxy)-2-methoxycyclobutan-1-amine.
| Compound Name | 3-(2,3-dimethylphenoxy)-2-methoxycyclobutan-1-amine |
|---|---|
| PubChem CID | 104674259 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 3-(2,3-dimethylphenoxy)-2-methoxycyclobutan-1-amine |
| SMILES | COC1C(N)CC1Oc1cccc(C)c1C |
| InChI | InChI=1S/C13H19NO2/c1-8-5-4-6-11(9(8)2)16-12-7-10(14)13(12)15-3/h4-6,10,12-13H,7,14H2,1-3H3 |
| InChIKey | AECPITBFOWLRLJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |