About N-(6,9-dimethyl-5H-pyrido[4,3-b]indol-7-yl)acetamide
N-(6,9-dimethyl-5H-pyrido[4,3-b]indol-7-yl)acetamide (PubChem CID 10467444) has the molecular formula C15H15N3O
and a molecular weight of 253.30 g/mol. Its IUPAC name is N-(6,9-dimethyl-5H-pyrido[4,3-b]indol-7-yl)acetamide.
Molecular Properties
| Compound Name | N-(6,9-dimethyl-5H-pyrido[4,3-b]indol-7-yl)acetamide |
| PubChem CID | 10467444 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | N-(6,9-dimethyl-5H-pyrido[4,3-b]indol-7-yl)acetamide |
| SMILES | CC(=O)Nc1cc(C)c2c([nH]c3ccncc32)c1C |
| InChI | InChI=1S/C15H15N3O/c1-8-6-13(17-10(3)19)9(2)15-14(8)11-7-16-5-4-12(11)18-15/h4-7,18H,1-3H3,(H,17,19) |
| InChIKey | ILKZLVQKFBMYLQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(6,9-dimethyl-5H-pyrido[4,3-b]indol-7-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6,9-dimethyl-5H-pyrido[4,3-b]indol-7-yl)acetamide?
The IUPAC name of N-(6,9-dimethyl-5H-pyrido[4,3-b]indol-7-yl)acetamide (CID 10467444) is N-(6,9-dimethyl-5H-pyrido[4,3-b]indol-7-yl)acetamide.
What is the SMILES notation for N-(6,9-dimethyl-5H-pyrido[4,3-b]indol-7-yl)acetamide?
The canonical SMILES for N-(6,9-dimethyl-5H-pyrido[4,3-b]indol-7-yl)acetamide is CC(=O)Nc1cc(C)c2c([nH]c3ccncc32)c1C.
What is the InChIKey of N-(6,9-dimethyl-5H-pyrido[4,3-b]indol-7-yl)acetamide?
The InChIKey is ILKZLVQKFBMYLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O/c1-8-6-13(17-10(3)19)9(2)15-14(8)11-7-16-5-4-12(11)18-15/h4-7,18H,1-3H3,(H,17,19).
What are the key properties of N-(6,9-dimethyl-5H-pyrido[4,3-b]indol-7-yl)acetamide?
N-(6,9-dimethyl-5H-pyrido[4,3-b]indol-7-yl)acetamide has a molecular weight of 253.30 g/mol, XLogP of 3.29, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6,9-dimethyl-5H-pyrido[4,3-b]indol-7-yl)acetamide is sourced from PubChem (CID 10467444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).