C12H16BrN — CID 10467471
7-bromo-5-ethyl-2,3,4,5-tetrahydro-1H-3-benzazepine (PubChem CID 10467471) has the molecular formula C12H16BrN and a molecular weight of 254.17 g/mol. Its IUPAC name is 7-bromo-5-ethyl-2,3,4,5-tetrahydro-1H-3-benzazepine.
| Compound Name | 7-bromo-5-ethyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
|---|---|
| PubChem CID | 10467471 |
| Molecular Formula | C12H16BrN |
| Molecular Weight | 254.17 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 7-bromo-5-ethyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
| SMILES | CCC1CNCCc2ccc(Br)cc21 |
| InChI | InChI=1S/C12H16BrN/c1-2-9-8-14-6-5-10-3-4-11(13)7-12(9)10/h3-4,7,9,14H,2,5-6,8H2,1H3 |
| InChIKey | FZAXXXCRTZYHAH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.17 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |