C10H10N2O4S — CID 10467478
N-(1,2-benzoxazol-3-ylmethylsulfonyl)acetamide (PubChem CID 10467478) has the molecular formula C10H10N2O4S and a molecular weight of 254.27 g/mol. Its IUPAC name is N-(1,2-benzoxazol-3-ylmethylsulfonyl)acetamide.
| Compound Name | N-(1,2-benzoxazol-3-ylmethylsulfonyl)acetamide |
|---|---|
| PubChem CID | 10467478 |
| Molecular Formula | C10H10N2O4S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | N-(1,2-benzoxazol-3-ylmethylsulfonyl)acetamide |
| SMILES | CC(=O)NS(=O)(=O)Cc1noc2ccccc12 |
| InChI | InChI=1S/C10H10N2O4S/c1-7(13)12-17(14,15)6-9-8-4-2-3-5-10(8)16-11-9/h2-5H,6H2,1H3,(H,12,13) |
| InChIKey | HXFUTAFSEXINIW-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |