C11H12Br2N2O4 — CID 104674789
3-(2,6-dibromo-4-nitrophenoxy)-2-methoxycyclobutan-1-amine (PubChem CID 104674789) has the molecular formula C11H12Br2N2O4 and a molecular weight of 396.04 g/mol. Its IUPAC name is 3-(2,6-dibromo-4-nitrophenoxy)-2-methoxycyclobutan-1-amine.
| Compound Name | 3-(2,6-dibromo-4-nitrophenoxy)-2-methoxycyclobutan-1-amine |
|---|---|
| PubChem CID | 104674789 |
| Molecular Formula | C11H12Br2N2O4 |
| Molecular Weight | 396.04 g/mol |
| Exact Mass | 393.92 |
| IUPAC Name | 3-(2,6-dibromo-4-nitrophenoxy)-2-methoxycyclobutan-1-amine |
| SMILES | COC1C(N)CC1Oc1c(Br)cc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C11H12Br2N2O4/c1-18-11-8(14)4-9(11)19-10-6(12)2-5(15(16)17)3-7(10)13/h2-3,8-9,11H,4,14H2,1H3 |
| InChIKey | FBALBKYTDGLZTH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.04 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|