C16H21ClO3 — CID 104675156
3-(4-chloro-2-methyl-5-propan-2-ylphenoxy)-2-ethoxycyclobutan-1-one (PubChem CID 104675156) has the molecular formula C16H21ClO3 and a molecular weight of 296.79 g/mol. Its IUPAC name is 3-(4-chloro-2-methyl-5-propan-2-ylphenoxy)-2-ethoxycyclobutan-1-one.
| Compound Name | 3-(4-chloro-2-methyl-5-propan-2-ylphenoxy)-2-ethoxycyclobutan-1-one |
|---|---|
| PubChem CID | 104675156 |
| Molecular Formula | C16H21ClO3 |
| Molecular Weight | 296.79 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-(4-chloro-2-methyl-5-propan-2-ylphenoxy)-2-ethoxycyclobutan-1-one |
| SMILES | CCOC1C(=O)CC1Oc1cc(C(C)C)c(Cl)cc1C |
| InChI | InChI=1S/C16H21ClO3/c1-5-19-16-13(18)8-15(16)20-14-7-11(9(2)3)12(17)6-10(14)4/h6-7,9,15-16H,5,8H2,1-4H3 |
| InChIKey | HIQMIOPWPXPXNI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.79 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |