C12H12Cl3NO4 — CID 104675775
1,3-dichloro-2-(3-chloro-2-ethoxycyclobutyl)oxy-5-nitrobenzene (PubChem CID 104675775) has the molecular formula C12H12Cl3NO4 and a molecular weight of 340.59 g/mol. Its IUPAC name is 1,3-dichloro-2-(3-chloro-2-ethoxycyclobutyl)oxy-5-nitrobenzene.
| Compound Name | 1,3-dichloro-2-(3-chloro-2-ethoxycyclobutyl)oxy-5-nitrobenzene |
|---|---|
| PubChem CID | 104675775 |
| Molecular Formula | C12H12Cl3NO4 |
| Molecular Weight | 340.59 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | 1,3-dichloro-2-(3-chloro-2-ethoxycyclobutyl)oxy-5-nitrobenzene |
| SMILES | CCOC1C(Cl)CC1Oc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C12H12Cl3NO4/c1-2-19-12-9(15)5-10(12)20-11-7(13)3-6(16(17)18)4-8(11)14/h3-4,9-10,12H,2,5H2,1H3 |
| InChIKey | RUWLBJWQGNMWIJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|