C15H21BrClNO2 — CID 104676536
3-(5-bromo-2-chlorophenoxy)-2-ethoxy-N-propylcyclobutan-1-amine (PubChem CID 104676536) has the molecular formula C15H21BrClNO2 and a molecular weight of 362.70 g/mol. Its IUPAC name is 3-(5-bromo-2-chlorophenoxy)-2-ethoxy-N-propylcyclobutan-1-amine.
| Compound Name | 3-(5-bromo-2-chlorophenoxy)-2-ethoxy-N-propylcyclobutan-1-amine |
|---|---|
| PubChem CID | 104676536 |
| Molecular Formula | C15H21BrClNO2 |
| Molecular Weight | 362.70 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 3-(5-bromo-2-chlorophenoxy)-2-ethoxy-N-propylcyclobutan-1-amine |
| SMILES | CCCNC1CC(Oc2cc(Br)ccc2Cl)C1OCC |
| InChI | InChI=1S/C15H21BrClNO2/c1-3-7-18-12-9-14(15(12)19-4-2)20-13-8-10(16)5-6-11(13)17/h5-6,8,12,14-15,18H,3-4,7,9H2,1-2H3 |
| InChIKey | WXHUUXLZPXTKOF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.70 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |