About 1-diphenylphosphoryl-N,N-diethylcyclobutane-1-carboxamide
1-diphenylphosphoryl-N,N-diethylcyclobutane-1-carboxamide (PubChem CID 1046768) has the molecular formula C21H26NO2P
and a molecular weight of 355.42 g/mol. Its IUPAC name is 1-diphenylphosphoryl-N,N-diethylcyclobutane-1-carboxamide.
Molecular Properties
| Compound Name | 1-diphenylphosphoryl-N,N-diethylcyclobutane-1-carboxamide |
| PubChem CID | 1046768 |
| Molecular Formula | C21H26NO2P |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 1-diphenylphosphoryl-N,N-diethylcyclobutane-1-carboxamide |
| SMILES | CCN(CC)C(=O)C1(P(=O)(c2ccccc2)c2ccccc2)CCC1 |
| InChI | InChI=1S/C21H26NO2P/c1-3-22(4-2)20(23)21(16-11-17-21)25(24,18-12-7-5-8-13-18)19-14-9-6-10-15-19/h5-10,12-15H,3-4,11,16-17H2,1-2H3 |
| InChIKey | MGWNSTPKSZCDFT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-diphenylphosphoryl-N,N-diethylcyclobutane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diphenylphosphoryl-N,N-diethylcyclobutane-1-carboxamide?
The IUPAC name of 1-diphenylphosphoryl-N,N-diethylcyclobutane-1-carboxamide (CID 1046768) is 1-diphenylphosphoryl-N,N-diethylcyclobutane-1-carboxamide.
What is the SMILES notation for 1-diphenylphosphoryl-N,N-diethylcyclobutane-1-carboxamide?
The canonical SMILES for 1-diphenylphosphoryl-N,N-diethylcyclobutane-1-carboxamide is CCN(CC)C(=O)C1(P(=O)(c2ccccc2)c2ccccc2)CCC1.
What is the InChIKey of 1-diphenylphosphoryl-N,N-diethylcyclobutane-1-carboxamide?
The InChIKey is MGWNSTPKSZCDFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26NO2P/c1-3-22(4-2)20(23)21(16-11-17-21)25(24,18-12-7-5-8-13-18)19-14-9-6-10-15-19/h5-10,12-15H,3-4,11,16-17H2,1-2H3.
What are the key properties of 1-diphenylphosphoryl-N,N-diethylcyclobutane-1-carboxamide?
1-diphenylphosphoryl-N,N-diethylcyclobutane-1-carboxamide has a molecular weight of 355.42 g/mol, XLogP of 3.79, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diphenylphosphoryl-N,N-diethylcyclobutane-1-carboxamide is sourced from PubChem (CID 1046768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).