About N-(4-methylcyclohexyl)-6,7-dihydro-5H-cyclopenta[b]pyrazine-3-carboxamide
N-(4-methylcyclohexyl)-6,7-dihydro-5H-cyclopenta[b]pyrazine-3-carboxamide (PubChem CID 10467752) has the molecular formula C15H21N3O
and a molecular weight of 259.35 g/mol. Its IUPAC name is N-(4-methylcyclohexyl)-6,7-dihydro-5H-cyclopenta[b]pyrazine-3-carboxamide.
Molecular Properties
| Compound Name | N-(4-methylcyclohexyl)-6,7-dihydro-5H-cyclopenta[b]pyrazine-3-carboxamide |
| PubChem CID | 10467752 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N-(4-methylcyclohexyl)-6,7-dihydro-5H-cyclopenta[b]pyrazine-3-carboxamide |
| SMILES | CC1CCC(NC(=O)c2cnc3c(n2)CCC3)CC1 |
| InChI | InChI=1S/C15H21N3O/c1-10-5-7-11(8-6-10)17-15(19)14-9-16-12-3-2-4-13(12)18-14/h9-11H,2-8H2,1H3,(H,17,19) |
| InChIKey | FYEMTDOCAZIVGB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-methylcyclohexyl)-6,7-dihydro-5H-cyclopenta[b]pyrazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methylcyclohexyl)-6,7-dihydro-5H-cyclopenta[b]pyrazine-3-carboxamide?
The IUPAC name of N-(4-methylcyclohexyl)-6,7-dihydro-5H-cyclopenta[b]pyrazine-3-carboxamide (CID 10467752) is N-(4-methylcyclohexyl)-6,7-dihydro-5H-cyclopenta[b]pyrazine-3-carboxamide.
What is the SMILES notation for N-(4-methylcyclohexyl)-6,7-dihydro-5H-cyclopenta[b]pyrazine-3-carboxamide?
The canonical SMILES for N-(4-methylcyclohexyl)-6,7-dihydro-5H-cyclopenta[b]pyrazine-3-carboxamide is CC1CCC(NC(=O)c2cnc3c(n2)CCC3)CC1.
What is the InChIKey of N-(4-methylcyclohexyl)-6,7-dihydro-5H-cyclopenta[b]pyrazine-3-carboxamide?
The InChIKey is FYEMTDOCAZIVGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O/c1-10-5-7-11(8-6-10)17-15(19)14-9-16-12-3-2-4-13(12)18-14/h9-11H,2-8H2,1H3,(H,17,19).
What are the key properties of N-(4-methylcyclohexyl)-6,7-dihydro-5H-cyclopenta[b]pyrazine-3-carboxamide?
N-(4-methylcyclohexyl)-6,7-dihydro-5H-cyclopenta[b]pyrazine-3-carboxamide has a molecular weight of 259.35 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methylcyclohexyl)-6,7-dihydro-5H-cyclopenta[b]pyrazine-3-carboxamide is sourced from PubChem (CID 10467752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).