C13H26N4O3S — CID 104677903
4-[2-[1-(aminomethyl)cyclohexyl]acetyl]piperazine-1-sulfonamide (PubChem CID 104677903) has the molecular formula C13H26N4O3S and a molecular weight of 318.44 g/mol. Its IUPAC name is 4-[2-[1-(aminomethyl)cyclohexyl]acetyl]piperazine-1-sulfonamide.
| Compound Name | 4-[2-[1-(aminomethyl)cyclohexyl]acetyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 104677903 |
| Molecular Formula | C13H26N4O3S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 4-[2-[1-(aminomethyl)cyclohexyl]acetyl]piperazine-1-sulfonamide |
| SMILES | NCC1(CC(=O)N2CCN(S(N)(=O)=O)CC2)CCCCC1 |
| InChI | InChI=1S/C13H26N4O3S/c14-11-13(4-2-1-3-5-13)10-12(18)16-6-8-17(9-7-16)21(15,19)20/h1-11,14H2,(H2,15,19,20) |
| InChIKey | SHBNVBMCMZFOIK-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |